Products 2726971-51-1
CAS 2726971-51-1 is the registry number for Ropivacaine Impurity 43. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-N-(2,6-dimethylphenyl)-1-oxido-1-propylpiperidin-1-ium-2-carboxamide (CAS 2726971-51-1) is a chemical compound with the molecular formula C17H26N2O2 and a molecular weight of 290.4 g/mol. IUPAC name: (2R)-N-(2,6-dimethylphenyl)-1-oxido-1-propylpiperidin-1-ium-2-carboxamide. InChIKey: RVWGBWHPDXEKHY-NYRJJRHWSA-N.
| Molecular formula | C17H26N2O2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | (2R)-N-(2,6-dimethylphenyl)-1-oxido-1-propylpiperidin-1-ium-2-carboxamide |
| InChIKey | RVWGBWHPDXEKHY-NYRJJRHWSA-N |
| SMILES | CCC[N+]1(CCCC[C@@H]1C(=O)NC2=C(C=CC=C2C)C)[O-] |
Computed by PubChem (NCBI)