CAS 1391072-81-3 appears in our catalog under these names: 6-Bromo-2-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline, 95%, 6-Bromo-2-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-bromo-2-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (CAS 1391072-81-3) is a chemical compound with the molecular formula C10H9BrF3N and a molecular weight of 280.08 g/mol. IUPAC name: 6-bromo-2-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline. InChIKey: GHYIKNDMJIMNJZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3N |
|---|---|
| Molecular weight | 280.08 g/mol |
| IUPAC name | 6-bromo-2-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| InChIKey | GHYIKNDMJIMNJZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)NC1C(F)(F)F |
Computed by PubChem (NCBI)