Products 1391212-56-8
CAS 1391212-56-8 appears in our catalog under these names: 7-Bromo-1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline, ≥95%, ≥95%, 7-Bromo-1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-bromo-1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline (CAS 1391212-56-8) is a chemical compound with the molecular formula C10H9BrF3N and a molecular weight of 280.08 g/mol. IUPAC name: 7-bromo-1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline. InChIKey: CXGGZUWFMCJWHT-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3N |
|---|---|
| Molecular weight | 280.08 g/mol |
| IUPAC name | 7-bromo-1-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | CXGGZUWFMCJWHT-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1C=CC(=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)