CAS 1703969-35-0 is the registry number for (R)-2-(3-Bromo-2,4,6-trifluorophenyl)pyrrolidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(3-bromo-2,4,6-trifluorophenyl)pyrrolidine (CAS 1703969-35-0) is a chemical compound with the molecular formula C10H9BrF3N and a molecular weight of 280.08 g/mol. IUPAC name: (2R)-2-(3-bromo-2,4,6-trifluorophenyl)pyrrolidine. InChIKey: JUNNIVUKOHEENA-SSDOTTSWSA-N.
| Molecular formula | C10H9BrF3N |
|---|---|
| Molecular weight | 280.08 g/mol |
| IUPAC name | (2R)-2-(3-bromo-2,4,6-trifluorophenyl)pyrrolidine |
| InChIKey | JUNNIVUKOHEENA-SSDOTTSWSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C(=C(C=C2F)F)Br)F |
Computed by PubChem (NCBI)