Products 2612300-51-1
CAS 2612300-51-1 is the registry number for 7-Bromo-5-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline (CAS 2612300-51-1) is a chemical compound with the molecular formula C10H9BrF3N and a molecular weight of 280.08 g/mol. IUPAC name: 7-bromo-5-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline. InChIKey: LXPGWXRWODXULE-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF3N |
|---|---|
| Molecular weight | 280.08 g/mol |
| IUPAC name | 7-bromo-5-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | LXPGWXRWODXULE-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=CC(=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)