CAS 1391355-48-8 appears in our catalog under these names: (S)-3-(1-Amino-2-hydroxyethyl)phenol hydrochloride, 98%, (S)-3-(1-Amino-2-hydroxyethyl)phenol hydrochloride, 97%, 97%, (S)-3-(1-Amino-2-hydroxyethyl)phenol hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-[(1S)-1-amino-2-hydroxyethyl]phenol;hydrochloride (CAS 1391355-48-8) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. IUPAC name: 3-[(1S)-1-amino-2-hydroxyethyl]phenol;hydrochloride. InChIKey: HUADLLHIHCGJGR-DDWIOCJRSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 3-[(1S)-1-amino-2-hydroxyethyl]phenol;hydrochloride |
| InChIKey | HUADLLHIHCGJGR-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC(=C1)O)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)