CAS 146812-68-2 appears in our catalog under these names: 3–(1–Amino–2–hydroxyethyl)phenol hydrochloride, 3-(1-Amino-2-hydroxyethyl)phenol hydrochloride, 3-(1-Amino-2-hydroxyethyl)phenol hydrochloride, 95%, 3-(1-Amino-2-hydroxyethyl)phenol hydrochloride 97%, 3-(1-Amino-2-hydroxyethyl)phenol hydrochloride, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 2,5g, 1g, 5g.
3-(1-amino-2-hydroxyethyl)phenol;hydrochloride (CAS 146812-68-2) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. IUPAC name: 3-(1-amino-2-hydroxyethyl)phenol;hydrochloride. InChIKey: HUADLLHIHCGJGR-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 3-(1-amino-2-hydroxyethyl)phenol;hydrochloride |
| InChIKey | HUADLLHIHCGJGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(CO)N.Cl |
Computed by PubChem (NCBI)