Products 1391439-03-4
CAS 1391439-03-4 appears in our catalog under these names: (S)–2–(4–Fluorophenyl)azetidine hydrochloride, (S)-2-(4-Fluorophenyl)azetidine hydrochloride, 97%, (S)-2-(4-Fluorophenyl)azetidine hydrochloride, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 5mg, 100mg, 250mg.
(2S)-2-(4-fluorophenyl)azetidine;hydrochloride (CAS 1391439-03-4) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: (2S)-2-(4-fluorophenyl)azetidine;hydrochloride. InChIKey: ZSYLILXYSPZTFI-FVGYRXGTSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | (2S)-2-(4-fluorophenyl)azetidine;hydrochloride |
| InChIKey | ZSYLILXYSPZTFI-FVGYRXGTSA-N |
| SMILES | C1CN[C@@H]1C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)