CAS 1391449-67-4 appears in our catalog under these names: (S)-1-(4-Ethoxyphenyl)ethan-1-amine hydrochloride, 95+%, (S)-1-(4-Ethoxyphenyl)ethan-1-amine hydrochloride, 98%, 98%, (S)-1-(4-Ethoxyphenyl)ethan-1-amine hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
(1S)-1-(4-ethoxyphenyl)ethanamine;hydrochloride (CAS 1391449-67-4) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: (1S)-1-(4-ethoxyphenyl)ethanamine;hydrochloride. InChIKey: SWFKPUQRJHGZGE-QRPNPIFTSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | (1S)-1-(4-ethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | SWFKPUQRJHGZGE-QRPNPIFTSA-N |
| SMILES | CCOC1=CC=C(C=C1)[C@H](C)N.Cl |
Computed by PubChem (NCBI)