CAS 856562-89-5 appears in our catalog under these names: (R)-1-(4-Ethoxyphenyl)ethanamine hydrochloride, 98%, 98%, (1r)-1-(4-Ethoxyphenyl)ethan-1-amine hydrochloride, 98+%, (R)-1-(4-Ethoxyphenyl)ethanamine hydrochloride, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(4-ethoxyphenyl)ethanamine;hydrochloride (CAS 856562-89-5) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: (1R)-1-(4-ethoxyphenyl)ethanamine;hydrochloride. InChIKey: SWFKPUQRJHGZGE-DDWIOCJRSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | (1R)-1-(4-ethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | SWFKPUQRJHGZGE-DDWIOCJRSA-N |
| SMILES | CCOC1=CC=C(C=C1)[C@@H](C)N.Cl |
Computed by PubChem (NCBI)