CAS 1391467-74-5 is the registry number for (R)–2–Amino–2–(4–isopropylphenyl)ethan–1–ol hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2R)-2-amino-2-(4-propan-2-ylphenyl)ethanol;hydrochloride (CAS 1391467-74-5) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: (2R)-2-amino-2-(4-propan-2-ylphenyl)ethanol;hydrochloride. InChIKey: PLNUTKFHQUESSK-MERQFXBCSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-propan-2-ylphenyl)ethanol;hydrochloride |
| InChIKey | PLNUTKFHQUESSK-MERQFXBCSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)