Products 1391484-89-1
CAS 1391484-89-1 appears in our catalog under these names: (S)–1–(4–(Trifluoromethoxy)phenyl)propan–1–amine hydrochloride, (S)-1-(4-(Trifluoromethoxy)phenyl)propan-1-amine hydrochloride, 95%, (S)-1-(4-(Trifluoromethoxy)phenyl)propan-1-amine hydrochloride, 97%, 97%. Offered by: GLPBio, Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-[4-(trifluoromethoxy)phenyl]propan-1-amine;hydrochloride (CAS 1391484-89-1) is a chemical compound with the molecular formula C10H13ClF3NO and a molecular weight of 255.66 g/mol. IUPAC name: (1S)-1-[4-(trifluoromethoxy)phenyl]propan-1-amine;hydrochloride. InChIKey: DWKXJMLQLSYEPD-FVGYRXGTSA-N.
| Molecular formula | C10H13ClF3NO |
|---|---|
| Molecular weight | 255.66 g/mol |
| IUPAC name | (1S)-1-[4-(trifluoromethoxy)phenyl]propan-1-amine;hydrochloride |
| InChIKey | DWKXJMLQLSYEPD-FVGYRXGTSA-N |
| SMILES | CC[C@@H](C1=CC=C(C=C1)OC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)