Products 2260936-43-2
CAS 2260936-43-2 is the registry number for 3-(Propan-2-yloxy)-5-(trifluoromethyl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 10g.
3-propan-2-yloxy-5-(trifluoromethyl)aniline;hydrochloride (CAS 2260936-43-2) is a chemical compound with the molecular formula C10H13ClF3NO and a molecular weight of 255.66 g/mol. IUPAC name: 3-propan-2-yloxy-5-(trifluoromethyl)aniline;hydrochloride. InChIKey: MRYWELITKUHYJE-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF3NO |
|---|---|
| Molecular weight | 255.66 g/mol |
| IUPAC name | 3-propan-2-yloxy-5-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | MRYWELITKUHYJE-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=CC(=C1)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)