CAS 1476729-66-4 appears in our catalog under these names: 1-(4-(Trifluoromethoxy)phenyl)propan-1-amine hydrochloride, 95%, 1-(4-(Trifluoromethoxy)phenyl)propan-1-amine hcl, 97%, 97%, 1-(4-(Trifluoromethoxy)phenyl)propan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-[4-(trifluoromethoxy)phenyl]propan-1-amine;hydrochloride (CAS 1476729-66-4) is a chemical compound with the molecular formula C10H13ClF3NO and a molecular weight of 255.66 g/mol. IUPAC name: 1-[4-(trifluoromethoxy)phenyl]propan-1-amine;hydrochloride. InChIKey: DWKXJMLQLSYEPD-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF3NO |
|---|---|
| Molecular weight | 255.66 g/mol |
| IUPAC name | 1-[4-(trifluoromethoxy)phenyl]propan-1-amine;hydrochloride |
| InChIKey | DWKXJMLQLSYEPD-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)OC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)