Products 2569698-50-4
CAS 2569698-50-4 is the registry number for (R)-2-(3-(1-Aminoethyl)-2-fluorophenyl)-2,2-difluoroethan-1-ol hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-[(1R)-1-aminoethyl]-2-fluorophenyl]-2,2-difluoroethanol;hydrochloride (CAS 2569698-50-4) is a chemical compound with the molecular formula C10H13ClF3NO and a molecular weight of 255.66 g/mol. IUPAC name: 2-[3-[(1R)-1-aminoethyl]-2-fluorophenyl]-2,2-difluoroethanol;hydrochloride. InChIKey: HQJVWDNQCJXEAB-FYZOBXCZSA-N.
| Molecular formula | C10H13ClF3NO |
|---|---|
| Molecular weight | 255.66 g/mol |
| IUPAC name | 2-[3-[(1R)-1-aminoethyl]-2-fluorophenyl]-2,2-difluoroethanol;hydrochloride |
| InChIKey | HQJVWDNQCJXEAB-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=C(C(=CC=C1)C(CO)(F)F)F)N.Cl |
Computed by PubChem (NCBI)