Products 1391507-80-4
CAS 1391507-80-4 appears in our catalog under these names: 3-Methoxy-d-phenylalanine methyl ester hydrochloride, 95%, 3–Methoxy–D–phenylalanine methyl ester hydrochloride, 3-Methoxy-D-phenylalanine methyl ester hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
Methyl (2R)-2-amino-3-(3-methoxyphenyl)propanoate;hydrochloride (CAS 1391507-80-4) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: methyl (2R)-2-amino-3-(3-methoxyphenyl)propanoate;hydrochloride. InChIKey: FECZUOHUAFORHP-HNCPQSOCSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(3-methoxyphenyl)propanoate;hydrochloride |
| InChIKey | FECZUOHUAFORHP-HNCPQSOCSA-N |
| SMILES | COC1=CC=CC(=C1)C[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-Methoxy-D-phenylalanine methyl ester hydrochloride, 3-Methoxy-D-phenylalanine methyl ester HCl, methyl (2R)-2-amino-3-(3-methoxyphenyl)propanoate;hydrochloride, Benzyl D-Threoninate Hydrochloride, 3-Methoxy-D-phenylalaninemethylesterhydrochloride, (R)-methyl 2-amino-3-(3-methoxyphenyl)propanoate hydrochloride