CAS 70601-64-8 appears in our catalog under these names: (R)-Methyl 2-amino-3-(4-methoxyphenyl)propanoate hydrochloride, 95%, (R)-Methyl 2-amino-3-(4-methoxyphenyl)propanoate hydrochloride, 97%, METHYL (2R)-2-AMINO-3-(4-METHOXYPHENYL)PROPANOATE HCL, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
Methyl (2R)-2-amino-3-(4-methoxyphenyl)propanoate;hydrochloride (CAS 70601-64-8) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-methoxyphenyl)propanoate;hydrochloride. InChIKey: CDCIQNBPLQWUQS-HNCPQSOCSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-methoxyphenyl)propanoate;hydrochloride |
| InChIKey | CDCIQNBPLQWUQS-HNCPQSOCSA-N |
| SMILES | COC1=CC=C(C=C1)C[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)