CAS 16899-81-3 appears in our catalog under these names: 3',4'-Dihydroxy-2-(isopropylamino)acetophenone hydrochloride, 1-(3,4-Dihydroxyphenyl)-2-[(1-methylethyl)amino]ethanone hydrochloride, 95%, Isoproterenone HCl, Isoprenaline HCl EP Impurity A HCl, Norepinephrine Impurity 10. Offered by: Biosynth, Combi-blocks, Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: 1g, 5g, 250mg, on request, 10mg, 25mg, 50mg, 100mg.
1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone;hydrochloride (CAS 16899-81-3) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: 1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone;hydrochloride. InChIKey: IUNGEEAXDFWWSQ-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO3 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone;hydrochloride |
| InChIKey | IUNGEEAXDFWWSQ-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(=O)C1=CC(=C(C=C1)O)O.Cl |
Computed by PubChem (NCBI)