Products 1185301-31-8

CAS 1185301-31-8 is the registry number for 1-(2-Furylmethyl)-3-piperidinecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-(furan-2-ylmethyl)piperidine-3-carboxylic acid;hydrochloride (CAS 1185301-31-8) is a chemical compound with the molecular formula C11H16ClNO3 and a molecular weight of 245.70 g/mol. IUPAC name: 1-(furan-2-ylmethyl)piperidine-3-carboxylic acid;hydrochloride. InChIKey: ASKNLWZWRVKGOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO3
Molecular weight245.70 g/mol
IUPAC name1-(furan-2-ylmethyl)piperidine-3-carboxylic acid;hydrochloride
InChIKeyASKNLWZWRVKGOZ-UHFFFAOYSA-N
SMILESC1CC(CN(C1)CC2=CC=CO2)C(=O)O.Cl

Computed by PubChem (NCBI)