CAS 1391514-45-6 is the registry number for (R)–2–(2–Bromo–5–fluorophenyl)pyrrolidine hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2R)-2-(2-bromo-5-fluorophenyl)pyrrolidine;hydrochloride (CAS 1391514-45-6) is a chemical compound with the molecular formula C10H12BrClFN and a molecular weight of 280.56 g/mol. IUPAC name: (2R)-2-(2-bromo-5-fluorophenyl)pyrrolidine;hydrochloride. InChIKey: MQZUYNPQTUXEGZ-HNCPQSOCSA-N.
| Molecular formula | C10H12BrClFN |
|---|---|
| Molecular weight | 280.56 g/mol |
| IUPAC name | (2R)-2-(2-bromo-5-fluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | MQZUYNPQTUXEGZ-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C=CC(=C2)F)Br.Cl |
Computed by PubChem (NCBI)