CAS 1414958-49-8 appears in our catalog under these names: 7-Bromo-5-fluoro-1-methyl-1,2,3,4-tetrahydro-isoquinoline hydrochloride, 96%, 7-Bromo-5-fluoro-1-methyl-1,2,3,4-tetrahydro-isoquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-bromo-5-fluoro-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 1414958-49-8) is a chemical compound with the molecular formula C10H12BrClFN and a molecular weight of 280.56 g/mol. IUPAC name: 7-bromo-5-fluoro-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: HHKIIBDSMMVLHM-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClFN |
|---|---|
| Molecular weight | 280.56 g/mol |
| IUPAC name | 7-bromo-5-fluoro-1-methyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | HHKIIBDSMMVLHM-UHFFFAOYSA-N |
| SMILES | CC1C2=C(CCN1)C(=CC(=C2)Br)F.Cl |
Computed by PubChem (NCBI)