CAS 1807885-05-7 appears in our catalog under these names: (1R,3r)-3-(3-bromo-4-fluorophenyl)cyclobutan-1-amine hydrochloride, 95%, 3-(3-Bromo-4-fluorophenyl)cyclobutan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3-bromo-4-fluorophenyl)cyclobutan-1-amine;hydrochloride (CAS 1807885-05-7) is a chemical compound with the molecular formula C10H12BrClFN and a molecular weight of 280.56 g/mol. IUPAC name: 3-(3-bromo-4-fluorophenyl)cyclobutan-1-amine;hydrochloride. InChIKey: RWCTVAJILHEEIS-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClFN |
|---|---|
| Molecular weight | 280.56 g/mol |
| IUPAC name | 3-(3-bromo-4-fluorophenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | RWCTVAJILHEEIS-UHFFFAOYSA-N |
| SMILES | C1C(CC1N)C2=CC(=C(C=C2)F)Br.Cl |
Computed by PubChem (NCBI)