CAS 2304584-12-9 appears in our catalog under these names: 2-(5-Bromo-2-fluorophenyl)pyrrolidine hydrochloride, 95%, 2–(5–BROMO–2–FLUOROPHENYL)PYRROLIDINE HCL, 2-(5-BROMO-2-FLUOROPHENYL)PYRROLIDINE HCL, 97%, 97%, 2-(5-BROMO-2-FLUOROPHENYL)PYRROLIDINE HCL, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-(5-bromo-2-fluorophenyl)pyrrolidine;hydrochloride (CAS 2304584-12-9) is a chemical compound with the molecular formula C10H12BrClFN and a molecular weight of 280.56 g/mol. IUPAC name: 2-(5-bromo-2-fluorophenyl)pyrrolidine;hydrochloride. InChIKey: RYRLZAFKNCDARR-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClFN |
|---|---|
| Molecular weight | 280.56 g/mol |
| IUPAC name | 2-(5-bromo-2-fluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | RYRLZAFKNCDARR-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=C(C=CC(=C2)Br)F.Cl |
Computed by PubChem (NCBI)