CAS 1391547-09-3 appears in our catalog under these names: (S)-Methyl 4-(piperidin-2-yl)benzoate hydrochloride, 95%, (S)–Methyl 4–(piperidin–2–yl)benzoate hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl 4-[(2S)-piperidin-2-yl]benzoate;hydrochloride (CAS 1391547-09-3) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: methyl 4-[(2S)-piperidin-2-yl]benzoate;hydrochloride. InChIKey: JHDNHEWPPXDXMA-YDALLXLXSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | methyl 4-[(2S)-piperidin-2-yl]benzoate;hydrochloride |
| InChIKey | JHDNHEWPPXDXMA-YDALLXLXSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)[C@@H]2CCCCN2.Cl |
Computed by PubChem (NCBI)