CAS 1391574-76-7 appears in our catalog under these names: Methyl (r)-4-(piperidin-2-yl)benzoate hydrochloride, 95%, (R)–Methyl 4–(piperidin–2–yl)benzoate hydrochloride, (R)-Methyl 4-(piperidin-2-yl)benzoate hydrochloride, 97%, 97%, (R)-Methyl 4-(piperidin-2-yl)benzoate hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Methyl 4-[(2R)-piperidin-2-yl]benzoate;hydrochloride (CAS 1391574-76-7) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: methyl 4-[(2R)-piperidin-2-yl]benzoate;hydrochloride. InChIKey: JHDNHEWPPXDXMA-UTONKHPSSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | methyl 4-[(2R)-piperidin-2-yl]benzoate;hydrochloride |
| InChIKey | JHDNHEWPPXDXMA-UTONKHPSSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)[C@H]2CCCCN2.Cl |
Computed by PubChem (NCBI)