Products 863769-42-0

CAS 863769-42-0 is the registry number for Methyl 4-(piperidin-2-yl)benzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 4-piperidin-2-ylbenzoate;hydrochloride (CAS 863769-42-0) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: methyl 4-piperidin-2-ylbenzoate;hydrochloride. InChIKey: JHDNHEWPPXDXMA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18ClNO2
Molecular weight255.74 g/mol
IUPAC namemethyl 4-piperidin-2-ylbenzoate;hydrochloride
InChIKeyJHDNHEWPPXDXMA-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)C2CCCCN2.Cl

Computed by PubChem (NCBI)