CAS 1392212-91-7 appears in our catalog under these names: 8–(Trifluoromethyl)chroman–4–amine hydrochloride, 8-(Trifluoromethyl)chroman-4-amine hydrochloride, 95%, 95%, 8-(Trifluoromethyl)chroman-4-amine hydrochloride, 97%, 8-(Trifluoromethyl)chroman-4-amine hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
8-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1392212-91-7) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 8-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: CZTHXVIPUSKPKD-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 8-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | CZTHXVIPUSKPKD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=CC=C2C(F)(F)F.Cl |
Computed by PubChem (NCBI)