Products 1392493-46-7
CAS 1392493-46-7 is the registry number for 2-amino-5-cyano-3-methyl-N-(methyl-d3)-Benzamide. Offered by: TRC. Available pack sizes: 10mg.
2-amino-5-cyano-3-methyl-N-(trideuteriomethyl)benzamide (CAS 1392493-46-7) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 192.23 g/mol. IUPAC name: 2-amino-5-cyano-3-methyl-N-(trideuteriomethyl)benzamide. InChIKey: UOCPQZOXOQZEGV-BMSJAHLVSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | 2-amino-5-cyano-3-methyl-N-(trideuteriomethyl)benzamide |
| InChIKey | UOCPQZOXOQZEGV-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)C1=C(C(=CC(=C1)C#N)C)N |
Computed by PubChem (NCBI)