CAS 890707-29-6 appears in our catalog under these names: 2-Amino-5-cyano-N-methyl-3-methylbenzamide, >95% (HPLC), 2–Amino–5–cyano–N,3–dimethylbenzamide, 2-Amino-5-cyano-N,3-dimethylbenzamide, 2-Amino-5-cyano-N,3-dimethylbenzamide 95%, 2-Amino-5-cyano-N,3-dimethylbenzamide, 95%, 95%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 500mg, 250mg, 10g, 5g, 25g, 100g.
2-amino-5-cyano-N,3-dimethylbenzamide (CAS 890707-29-6) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 2-amino-5-cyano-N,3-dimethylbenzamide. InChIKey: UOCPQZOXOQZEGV-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-amino-5-cyano-N,3-dimethylbenzamide |
| InChIKey | UOCPQZOXOQZEGV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C(=O)NC)C#N |
Computed by PubChem (NCBI)