Products 1392803-26-7
CAS 1392803-26-7 is the registry number for trans-3-(Boc-amino)-2,2-dimethylcyclobutane-carboxylic acid, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 50mg, 250mg.
Cis-(1S,3S)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 1392803-26-7) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: cis-(1S,3S)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: AOJXKOSBUVHAIA-SFYZADRCSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | cis-(1S,3S)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | AOJXKOSBUVHAIA-SFYZADRCSA-N |
| SMILES | CC1([C@H](C[C@@H]1NC(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)