CAS 1779745-51-5 is the registry number for 3-{((tert-Butoxy)carbonyl)amino}-2,2-dimethylcyclobutane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 1779745-51-5) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: AOJXKOSBUVHAIA-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | AOJXKOSBUVHAIA-UHFFFAOYSA-N |
| SMILES | CC1(C(CC1NC(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)