CAS 1392803-42-7 appears in our catalog under these names: 3-(Boc-aminomethyl)-3-methylazetidine hemioxalate, 95%, 3-(Boc-aminomethyl)-3-methylazetidine hemioxalate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
Tert-butyl N-[(3-methylazetidin-3-yl)methyl]carbamate;oxalic acid (CAS 1392803-42-7) is a chemical compound with the molecular formula C12H22N2O6 and a molecular weight of 290.31 g/mol. IUPAC name: tert-butyl N-[(3-methylazetidin-3-yl)methyl]carbamate;oxalic acid. InChIKey: NKSRPSDNTABPGX-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O6 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | tert-butyl N-[(3-methylazetidin-3-yl)methyl]carbamate;oxalic acid |
| InChIKey | NKSRPSDNTABPGX-UHFFFAOYSA-N |
| SMILES | CC1(CNC1)CNC(=O)OC(C)(C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)