CAS 2459946-28-0 is the registry number for tert-butyl ((1S,3R)-3-aminocyclopentyl)carbamate oxalate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl N-[(1S,3R)-3-aminocyclopentyl]carbamate;oxalic acid (CAS 2459946-28-0) is a chemical compound with the molecular formula C12H22N2O6 and a molecular weight of 290.31 g/mol. IUPAC name: tert-butyl N-[(1S,3R)-3-aminocyclopentyl]carbamate;oxalic acid. InChIKey: RPAYXXHMFDTHSG-WLYNEOFISA-N.
| Molecular formula | C12H22N2O6 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | tert-butyl N-[(1S,3R)-3-aminocyclopentyl]carbamate;oxalic acid |
| InChIKey | RPAYXXHMFDTHSG-WLYNEOFISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](C1)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)