CAS 897045-90-8 appears in our catalog under these names: Calcium pantothenate EP Impurity E, Pantothenic acid calcium Impurity 2, Dexpanthenol Impurity 4, Vitamin B5 Impurity 1, N-D-Pantothenoyl-beta-Alanine, Calcium pantothenate EP Impurity E. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 5mg.
3-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]propanoic acid (CAS 897045-90-8) is a chemical compound with the molecular formula C12H22N2O6 and a molecular weight of 290.31 g/mol. IUPAC name: 3-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]propanoic acid. InChIKey: ZEFQNPXWTQSVAH-JTQLQIEISA-N.
| Molecular formula | C12H22N2O6 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | 3-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]propanoic acid |
| InChIKey | ZEFQNPXWTQSVAH-JTQLQIEISA-N |
| SMILES | CC(C)(CO)[C@H](C(=O)NCCC(=O)NCCC(=O)O)O |
Computed by PubChem (NCBI)