CAS 2920239-08-1 is the registry number for tert-butyl N-[(1S)-2-amino-1-cyclopropyl-ethyl]carbamate,oxalic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(1S)-2-amino-1-cyclopropylethyl]carbamate;oxalic acid (CAS 2920239-08-1) is a chemical compound with the molecular formula C12H22N2O6 and a molecular weight of 290.31 g/mol. IUPAC name: tert-butyl N-[(1S)-2-amino-1-cyclopropylethyl]carbamate;oxalic acid. InChIKey: WBALXINMGJMQJV-DDWIOCJRSA-N.
| Molecular formula | C12H22N2O6 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | tert-butyl N-[(1S)-2-amino-1-cyclopropylethyl]carbamate;oxalic acid |
| InChIKey | WBALXINMGJMQJV-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CN)C1CC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)