Products 2920239-08-1

CAS 2920239-08-1 is the registry number for tert-butyl N-[(1S)-2-amino-1-cyclopropyl-ethyl]carbamate,oxalic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(1S)-2-amino-1-cyclopropylethyl]carbamate;oxalic acid (CAS 2920239-08-1) is a chemical compound with the molecular formula C12H22N2O6 and a molecular weight of 290.31 g/mol. IUPAC name: tert-butyl N-[(1S)-2-amino-1-cyclopropylethyl]carbamate;oxalic acid. InChIKey: WBALXINMGJMQJV-DDWIOCJRSA-N.

Identity
Molecular formulaC12H22N2O6
Molecular weight290.31 g/mol
IUPAC nametert-butyl N-[(1S)-2-amino-1-cyclopropylethyl]carbamate;oxalic acid
InChIKeyWBALXINMGJMQJV-DDWIOCJRSA-N
SMILESCC(C)(C)OC(=O)N[C@H](CN)C1CC1.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)