CAS 1392804-92-0 is the registry number for 3-(Boc-amino)-4-trifluoromethylpyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl N-[4-(trifluoromethyl)-3-pyridinyl]carbamate (CAS 1392804-92-0) is a chemical compound with the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. IUPAC name: tert-butyl N-[4-(trifluoromethyl)-3-pyridinyl]carbamate. InChIKey: QMNYTBCUQSYLNR-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2O2 |
|---|---|
| Molecular weight | 262.23 g/mol |
| IUPAC name | tert-butyl N-[4-(trifluoromethyl)-3-pyridinyl]carbamate |
| InChIKey | QMNYTBCUQSYLNR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CN=C1)C(F)(F)F |
Computed by PubChem (NCBI)