CAS 695191-63-0 is the registry number for [3-(Trifluoromethyl)-5,6,7,8-tetrahydrocyclohepta[c]pyrazol-1(4h)-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetic acid (CAS 695191-63-0) is a chemical compound with the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. IUPAC name: 2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetic acid. InChIKey: DFMVUFNGENZIPQ-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2O2 |
|---|---|
| Molecular weight | 262.23 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-1-yl]acetic acid |
| InChIKey | DFMVUFNGENZIPQ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(CC1)N(N=C2C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)