CAS 2756181-02-7 is the registry number for N,N-Diethyl-4-nitro-3-(trifluoromethyl)aniline, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N,N-diethyl-4-nitro-3-(trifluoromethyl)aniline (CAS 2756181-02-7) is a chemical compound with the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. IUPAC name: N,N-diethyl-4-nitro-3-(trifluoromethyl)aniline. InChIKey: GWNFLMKWZGWSOD-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2O2 |
|---|---|
| Molecular weight | 262.23 g/mol |
| IUPAC name | N,N-diethyl-4-nitro-3-(trifluoromethyl)aniline |
| InChIKey | GWNFLMKWZGWSOD-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)