CAS 1606625-10-8 is the registry number for (2S)-2-Amino-n-[2-(trifluoromethoxy)phenyl]butanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2S)-2-amino-N-[2-(trifluoromethoxy)phenyl]butanamide (CAS 1606625-10-8) is a chemical compound with the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. IUPAC name: (2S)-2-amino-N-[2-(trifluoromethoxy)phenyl]butanamide. InChIKey: FODQBLLCKRVMKC-ZETCQYMHSA-N.
| Molecular formula | C11H13F3N2O2 |
|---|---|
| Molecular weight | 262.23 g/mol |
| IUPAC name | (2S)-2-amino-N-[2-(trifluoromethoxy)phenyl]butanamide |
| InChIKey | FODQBLLCKRVMKC-ZETCQYMHSA-N |
| SMILES | CC[C@@H](C(=O)NC1=CC=CC=C1OC(F)(F)F)N |
Computed by PubChem (NCBI)