CAS 1393182-18-7 is the registry number for 1-(3-Phenyl-3H-imidazo[4,5-b]pyridin-2-yl)ethanamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-(3-phenylimidazo[4,5-b]pyridin-2-yl)ethanamine (CAS 1393182-18-7) is a chemical compound with the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. IUPAC name: 1-(3-phenylimidazo[4,5-b]pyridin-2-yl)ethanamine. InChIKey: RUKYEUIBLMQJAH-UHFFFAOYSA-N.
| Molecular formula | C14H14N4 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | 1-(3-phenylimidazo[4,5-b]pyridin-2-yl)ethanamine |
| InChIKey | RUKYEUIBLMQJAH-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=C(N1C3=CC=CC=C3)N=CC=C2)N |
Computed by PubChem (NCBI)