CAS 4702-78-7 appears in our catalog under these names: Benzil dihydrazone, 95%, Benzil dihydrazone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 5g, 10g.
(2-hydrazinylidene-1,2-diphenylethylidene)hydrazine (CAS 4702-78-7) is a chemical compound with the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. IUPAC name: (2-hydrazinylidene-1,2-diphenylethylidene)hydrazine. InChIKey: ZWPOAAKGAFHAEX-UHFFFAOYSA-N.
| Molecular formula | C14H14N4 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | (2-hydrazinylidene-1,2-diphenylethylidene)hydrazine |
| InChIKey | ZWPOAAKGAFHAEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NN)C(=NN)C2=CC=CC=C2 |
Computed by PubChem (NCBI)