CAS 428845-73-2 is the registry number for 2,5-Dimethyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,5-dimethyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine (CAS 428845-73-2) is a chemical compound with the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. IUPAC name: 2,5-dimethyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine. InChIKey: UITLYEVZEXSXKR-UHFFFAOYSA-N.
| Molecular formula | C14H14N4 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | 2,5-dimethyl-6-phenylpyrazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | UITLYEVZEXSXKR-UHFFFAOYSA-N |
| SMILES | CC1=NN2C(=C1)N=C(C(=C2N)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)