CAS 378215-79-3 is the registry number for 6-Methyl-2-(4-methylphenyl)-2h-1,2,3-benzotriazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-methyl-2-(4-methylphenyl)benzotriazol-5-amine (CAS 378215-79-3) is a chemical compound with the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. IUPAC name: 6-methyl-2-(4-methylphenyl)benzotriazol-5-amine. InChIKey: WPWFGODZYVRBTJ-UHFFFAOYSA-N.
| Molecular formula | C14H14N4 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | 6-methyl-2-(4-methylphenyl)benzotriazol-5-amine |
| InChIKey | WPWFGODZYVRBTJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2N=C3C=C(C(=CC3=N2)N)C |
Computed by PubChem (NCBI)