Products 139323-52-7
CAS 139323-52-7 is the registry number for 7’-OH-N-trityl morpholino uracil. Offered by: Biosynth. Available pack sizes: 1g, 0,5g.
1-[(2R,6S)-6-(hydroxymethyl)-4-tritylmorpholin-2-yl]pyrimidine-2,4-dione (CAS 139323-52-7) is a chemical compound with the molecular formula C28H27N3O4 and a molecular weight of 469.5 g/mol. IUPAC name: 1-[(2R,6S)-6-(hydroxymethyl)-4-tritylmorpholin-2-yl]pyrimidine-2,4-dione. InChIKey: UGNHTNPQXYRORJ-AZGAKELHSA-N.
| Molecular formula | C28H27N3O4 |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | 1-[(2R,6S)-6-(hydroxymethyl)-4-tritylmorpholin-2-yl]pyrimidine-2,4-dione |
| InChIKey | UGNHTNPQXYRORJ-AZGAKELHSA-N |
| SMILES | C1[C@H](O[C@H](CN1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)N5C=CC(=O)NC5=O)CO |
Computed by PubChem (NCBI)