Products 2244341-81-7

CAS 2244341-81-7 is the registry number for SA91-0178, 98.1300%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 50 mg, 100 mg, 25 mg, 10 mg.

Structural formula: {0} (CAS {1})

3-[[(1-methyl-2-oxo-1'-phenylspiro[indole-3,4'-piperidine]-5-carbonyl)amino]methyl]benzoic acid (CAS 2244341-81-7) is a chemical compound with the molecular formula C28H27N3O4 and a molecular weight of 469.5 g/mol. IUPAC name: 3-[[(1-methyl-2-oxo-1'-phenylspiro[indole-3,4'-piperidine]-5-carbonyl)amino]methyl]benzoic acid. InChIKey: ABKWGUHBAKVSKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC28H27N3O4
Molecular weight469.5 g/mol
IUPAC name3-[[(1-methyl-2-oxo-1'-phenylspiro[indole-3,4'-piperidine]-5-carbonyl)amino]methyl]benzoic acid
InChIKeyABKWGUHBAKVSKJ-UHFFFAOYSA-N
SMILESCN1C2=C(C=C(C=C2)C(=O)NCC3=CC(=CC=C3)C(=O)O)C4(C1=O)CCN(CC4)C5=CC=CC=C5

Computed by PubChem (NCBI)

Synonyms: orb3027370