CAS 2504235-67-8 appears in our catalog under these names: CFT7455/ 97.93% (existing batch purity), CFT7455, CFT7455, 97%, 97%, Cemsidomide, 99.54%, Cemsidomide, 97%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 100 mg.
(3S)-3-[6-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione (CAS 2504235-67-8) is a chemical compound with the molecular formula C28H27N3O4 and a molecular weight of 469.5 g/mol. IUPAC name: (3S)-3-[6-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione. InChIKey: MUKCJOOKCZSQNW-DEOSSOPVSA-N.
| Molecular formula | C28H27N3O4 |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | (3S)-3-[6-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
| InChIKey | MUKCJOOKCZSQNW-DEOSSOPVSA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2C3=C4C(=C(C=C3)CC5=CC=C(C=C5)CN6CCOCC6)C=CC=C4C2=O |
Computed by PubChem (NCBI)