Products 1435265-06-7
CAS 1435265-06-7 appears in our catalog under these names: HCH6-1/ 100%, HCH6-1, Methyl benzoyl-L-tryptophyl-D-phenylalaninate, 99%, 99%, HCH6-1, 99.16%, HCH6-1 (Standard). Offered by: TargetMol, Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg.
Methyl (2R)-2-[[(2S)-2-benzamido-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoate (CAS 1435265-06-7) is a chemical compound with the molecular formula C28H27N3O4 and a molecular weight of 469.5 g/mol. IUPAC name: methyl (2R)-2-[[(2S)-2-benzamido-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoate. InChIKey: MPFZAIDTRUPTSU-LOSJGSFVSA-N.
| Molecular formula | C28H27N3O4 |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | methyl (2R)-2-[[(2S)-2-benzamido-3-(1H-indol-3-yl)propanoyl]amino]-3-phenylpropanoate |
| InChIKey | MPFZAIDTRUPTSU-LOSJGSFVSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)[C@H](CC2=CNC3=CC=CC=C32)NC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)