Products 1393442-65-3
CAS 1393442-65-3 appears in our catalog under these names: 5-Bromo-6,7-difluoro-1-methylbenzotriazole, 96%, 5-Bromo-6,7-difluoro-1-methyl-1H-benzo(d)(1,2,3)triazole, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-bromo-6,7-difluoro-1-methylbenzotriazole (CAS 1393442-65-3) is a chemical compound with the molecular formula C7H4BrF2N3 and a molecular weight of 248.03 g/mol. IUPAC name: 5-bromo-6,7-difluoro-1-methylbenzotriazole. InChIKey: YHCPPQCLQCMBSO-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2N3 |
|---|---|
| Molecular weight | 248.03 g/mol |
| IUPAC name | 5-bromo-6,7-difluoro-1-methylbenzotriazole |
| InChIKey | YHCPPQCLQCMBSO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=C(C=C2N=N1)Br)F)F |
Computed by PubChem (NCBI)