Products 1440512-65-1
CAS 1440512-65-1 is the registry number for 8-Bromo-3-(difluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-bromo-3-(difluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine (CAS 1440512-65-1) is a chemical compound with the molecular formula C7H4BrF2N3 and a molecular weight of 248.03 g/mol. IUPAC name: 8-bromo-3-(difluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: DAVHZEZZIJDWPQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2N3 |
|---|---|
| Molecular weight | 248.03 g/mol |
| IUPAC name | 8-bromo-3-(difluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | DAVHZEZZIJDWPQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NN=C2C(F)F)C(=C1)Br |
Computed by PubChem (NCBI)