CAS 2366185-17-1 is the registry number for 3-Bromo-5-(difluoromethyl)pyrazolo[1,5-a]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5-(difluoromethyl)pyrazolo[1,5-a]pyrimidine (CAS 2366185-17-1) is a chemical compound with the molecular formula C7H4BrF2N3 and a molecular weight of 248.03 g/mol. IUPAC name: 3-bromo-5-(difluoromethyl)pyrazolo[1,5-a]pyrimidine. InChIKey: VLGREUANZKPDNF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2N3 |
|---|---|
| Molecular weight | 248.03 g/mol |
| IUPAC name | 3-bromo-5-(difluoromethyl)pyrazolo[1,5-a]pyrimidine |
| InChIKey | VLGREUANZKPDNF-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)Br)N=C1C(F)F |
Computed by PubChem (NCBI)